Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]oxolan-2-yl]methyl]-4-(dimethylamino)benzamide
ID: Reference9122
Other Names: NAT19-353782
Formula: C26H34N4O5
N-({(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(4-phenyl-1-piperazinyl)ethyl]tetrahydro-2-furanyl}methyl)-4-(dimethylamino)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3331 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2024 1:37:41 PM |
| InChI | InChI=1S/C26H34N4O5/c1-28(2)19-10-8-18(9-11-19)26(34)27-17-22-25(33)24(32)21(35-22)16-23(31)30-14-12-29(13-15-30)20-6-4-3-5-7-20/h3-11,21-22,24-25,32-33H,12-17H2,1-2H3,(H,27,34)/t21-,22+,24-,25+/m0/s1 |
| InChI Key | AATQYYREKPWTKJ-TVYALGDOSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCC2C(C(C(O2)CC(=O)N3CCN(CC3)C4=CC=CC=C4)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353782 |