Systematic / IUPAC Name: 1-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-(2-morpholin-4-yl-2-oxoethyl)oxolan-2-yl]methyl]-3-(3-fluorophenyl)urea
ID: Reference9123
Other Names: NAT19-353980
Formula: C18H24FN3O6
1-({(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-(4-morpholinyl)-2-oxoethyl]tetrahydro-2-furanyl}methyl)-3-(3-fluorophenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1886 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/14/2019 7:39:09 AM |
| InChI | InChI=1S/C18H24FN3O6/c19-11-2-1-3-12(8-11)21-18(26)20-10-14-17(25)16(24)13(28-14)9-15(23)22-4-6-27-7-5-22/h1-3,8,13-14,16-17,24-25H,4-7,9-10H2,(H2,20,21,26)/t13-,14+,16-,17+/m0/s1 |
| InChI Key | NLINOGOTNKVVSW-HDEZJCGLSA-N |
| Canonical SMILES | C1COCCN1C(=O)CC2C(C(C(O2)CNC(=O)NC3=CC(=CC=C3)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353980 |