Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methyl]methanesulfonamide
ID: Reference9124
Other Names: NAT19-347679
Formula: C19H29N3O7S
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[4-(2-methoxyphenyl)-1-piperazinyl]-2-oxoethyl}tetrahydro-2-furanyl]methyl}methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1878 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/22/2019 11:35:25 AM |
| InChI | InChI=1S/C19H29N3O7S/c1-28-14-6-4-3-5-13(14)21-7-9-22(10-8-21)17(23)11-15-18(24)19(25)16(29-15)12-20-30(2,26)27/h3-6,15-16,18-20,24-25H,7-12H2,1-2H3/t15-,16+,18-,19+/m0/s1 |
| InChI Key | AODIWVKBIZZVAQ-OGWHTMIXSA-N |
| Canonical SMILES | COC1=CC=CC=C1N2CCN(CC2)C(=O)CC3C(C(C(O3)CNS(=O)(=O)C)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-347679 |