Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methyl]benzamide
ID: Reference9158
Other Names: NAT19-353914
Formula: C25H31N3O6
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[4-(2-methoxyphenyl)-1-piperazinyl]-2-oxoethyl}tetrahydro-2-furanyl]methyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3578 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/22/2019 6:59:46 AM |
| InChI | InChI=1S/C25H31N3O6/c1-33-19-10-6-5-9-18(19)27-11-13-28(14-12-27)22(29)15-20-23(30)24(31)21(34-20)16-26-25(32)17-7-3-2-4-8-17/h2-10,20-21,23-24,30-31H,11-16H2,1H3,(H,26,32)/t20-,21+,23-,24+/m0/s1 |
| InChI Key | RUPBMYUQZJVAHL-SGKWCMOWSA-N |
| Canonical SMILES | COC1=CC=CC=C1N2CCN(CC2)C(=O)CC3C(C(C(O3)CNC(=O)C4=CC=CC=C4)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353914 |