Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(prop-2-ynylamino)ethyl]oxolan-2-yl]methyl]-3-fluorobenzamide
ID: Reference9163
Other Names: NAT19-354050
Formula: C17H19FN2O5
N-({(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(2-propyn-1-ylamino)ethyl]tetrahydro-2-furanyl}methyl)-3-fluorobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2471 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/22/2019 7:04:40 AM |
| InChI | InChI=1S/C17H19FN2O5/c1-2-6-19-14(21)8-12-15(22)16(23)13(25-12)9-20-17(24)10-4-3-5-11(18)7-10/h1,3-5,7,12-13,15-16,22-23H,6,8-9H2,(H,19,21)(H,20,24)/t12-,13+,15-,16+/m0/s1 |
| InChI Key | AESDNZAHIYIEPS-LQKXBSAESA-N |
| Canonical SMILES | C#CCNC(=O)CC1C(C(C(O1)CNC(=O)C2=CC(=CC=C2)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-354050 |