Systematic / IUPAC Name: 2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-[2-(dimethylamino)ethyl]acetamide
ID: Reference9166
Other Names: NAT19-353598
Formula: C15H30N4O5
2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-{[(isopropylcarbamoyl)amino]methyl}tetrahydro-2-furanyl]-N-[2-(dimethylamino)ethyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4361 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/27/2019 7:33:51 AM |
| InChI | InChI=1S/C15H30N4O5/c1-9(2)18-15(23)17-8-11-14(22)13(21)10(24-11)7-12(20)16-5-6-19(3)4/h9-11,13-14,21-22H,5-8H2,1-4H3,(H,16,20)(H2,17,18,23)/t10-,11+,13-,14+/m0/s1 |
| InChI Key | RPUVBRNPJRMXLF-UZGDPCLZSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(C(O1)CC(=O)NCCN(C)C)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353598 |