Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methyl]-4-(dimethylamino)benzamide
ID: Reference9176
Other Names: NAT19-353917
Formula: C27H36N4O6
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[4-(2-methoxyphenyl)-1-piperazinyl]-2-oxoethyl}tetrahydro-2-furanyl]methyl}-4-(dimethylamino)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1049 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/2/2019 8:46:56 AM |
| InChI | InChI=1S/C27H36N4O6/c1-29(2)19-10-8-18(9-11-19)27(35)28-17-23-26(34)25(33)22(37-23)16-24(32)31-14-12-30(13-15-31)20-6-4-5-7-21(20)36-3/h4-11,22-23,25-26,33-34H,12-17H2,1-3H3,(H,28,35)/t22-,23+,25-,26+/m0/s1 |
| InChI Key | UHLCHBCBMDPEIC-ALNDXVPUSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCC2C(C(C(O2)CC(=O)N3CCN(CC3)C4=CC=CC=C4OC)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353917 |