Systematic / IUPAC Name: 1-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-yl]methyl]-3-phenylurea
ID: Reference9180
Other Names: NAT19-353952
Formula: C23H29N5O5
1-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl}tetrahydro-2-furanyl]methyl}-3-phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 6014 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/2/2019 1:50:06 PM |
| InChI | InChI=1S/C23H29N5O5/c29-20(28-12-10-27(11-13-28)19-8-4-5-9-24-19)14-17-21(30)22(31)18(33-17)15-25-23(32)26-16-6-2-1-3-7-16/h1-9,17-18,21-22,30-31H,10-15H2,(H2,25,26,32)/t17-,18+,21-,22+/m0/s1 |
| InChI Key | FGKZSXUSHCDQNM-GKJHBJHPSA-N |
| Canonical SMILES | C1CN(CCN1C2=CC=CC=N2)C(=O)CC3C(C(C(O3)CNC(=O)NC4=CC=CC=C4)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353952 |