Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]oxolan-2-yl]methyl]-4-methylbenzamide
ID: Reference9188
Other Names: NAT19-354012
Formula: C21H30N2O5
N-({(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-(4-methyl-1-piperidinyl)-2-oxoethyl]tetrahydro-2-furanyl}methyl)-4-methylbenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3361 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/2/2019 2:06:44 PM |
| InChI | InChI=1S/C21H30N2O5/c1-13-3-5-15(6-4-13)21(27)22-12-17-20(26)19(25)16(28-17)11-18(24)23-9-7-14(2)8-10-23/h3-6,14,16-17,19-20,25-26H,7-12H2,1-2H3,(H,22,27)/t16-,17+,19-,20+/m0/s1 |
| InChI Key | DVGCKKWAGUGJOI-KVPLUYHFSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | NAT19-354012 |