Systematic / IUPAC Name: 2-[(3R,4S)-3-[(5-Phenyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone
ID: Reference9189
Other Names:
Ethanone, 2-[(3R,4S)-3-[(5-phenyl-3-isoxazolyl)methyl]-4-piperidinyl]-1-(4-phenyl-1-piperazinyl)-;
NAT14-350132
Formula: C27H32N4O2
2-{(3R,4S)-3-[(5-Phenyl-1,2-oxazol-3-yl)methyl]-4-piperidinyl}-1-(4-phenyl-1-piperazinyl)ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 837 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/2/2019 2:09:25 PM |
| InChI | InChI=1S/C27H32N4O2/c32-27(31-15-13-30(14-16-31)25-9-5-2-6-10-25)18-22-11-12-28-20-23(22)17-24-19-26(33-29-24)21-7-3-1-4-8-21/h1-10,19,22-23,28H,11-18,20H2/t22-,23-/m0/s1 |
| InChI Key | MWLJXZIAEBHIIP-GOTSBHOMSA-N |
| Canonical SMILES | C1CNCC(C1CC(=O)N2CCN(CC2)C3=CC=CC=C3)CC4=NOC(=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 2-[(3R,4S)-3-[(5-phenyl-3-isoxazolyl)methyl]-4-piperidinyl]-1-(4-phenyl-1-piperazinyl)-; NAT14-350132 |