Systematic / IUPAC Name: 1-Cyclohexyl-3-[[(2R,4S,5R)-5-(2-methyl-5-phenylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9196
Other Names:
Urea, N-cyclohexyl-N'-[[(2R,4S,5R)-5-(1-methyl-3-phenyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-332245
Formula: C25H35N5O
1-Cyclohexyl-3-{[(2R,4S,5R)-5-(1-methyl-3-phenyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3382 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/9/2019 10:02:16 AM |
| InChI | InChI=1S/C25H35N5O/c1-29-24(15-23(28-29)18-8-4-2-5-9-18)22-17-30-13-12-19(22)14-21(30)16-26-25(31)27-20-10-6-3-7-11-20/h2,4-5,8-9,15,19-22H,3,6-7,10-14,16-17H2,1H3,(H2,26,27,31)/t19-,21+,22-/m0/s1 |
| InChI Key | LRQZDOXBMAHDBC-NNWRFLSQSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CC=C2)C3CN4CCC3CC4CNC(=O)NC5CCCCC5 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-cyclohexyl-N'-[[(2R,4S,5R)-5-(1-methyl-3-phenyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-332245 |