Systematic / IUPAC Name: 1-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]oxolan-2-yl]methyl]-3-propan-2-ylurea
ID: Reference9207
Other Names: NAT19-353868
Formula: C17H31N3O6
1-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[(2R)-2-(methoxymethyl)-1-pyrrolidinyl]-2-oxoethyl}tetrahydro-2-furanyl]methyl}-3-isopropylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2328 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/5/2019 7:38:22 AM |
| InChI | InChI=1S/C17H31N3O6/c1-10(2)19-17(24)18-8-13-16(23)15(22)12(26-13)7-14(21)20-6-4-5-11(20)9-25-3/h10-13,15-16,22-23H,4-9H2,1-3H3,(H2,18,19,24)/t11-,12+,13-,15+,16-/m1/s1 |
| InChI Key | SQEJJTOBHJFEPP-HDNYOTOHSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(C(O1)CC(=O)N2CCCC2COC)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353868 |