Systematic / IUPAC Name: 2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide
ID: Reference9209
Other Names: NAT19-353733
Formula: C19H29N3O6
2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-{[(isopropylcarbamoyl)amino]methyl}tetrahydro-2-furanyl]-N-(4-methoxybenzyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4445 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/5/2019 7:40:15 AM |
| InChI | InChI=1S/C19H29N3O6/c1-11(2)22-19(26)21-10-15-18(25)17(24)14(28-15)8-16(23)20-9-12-4-6-13(27-3)7-5-12/h4-7,11,14-15,17-18,24-25H,8-10H2,1-3H3,(H,20,23)(H2,21,22,26)/t14-,15+,17-,18+/m0/s1 |
| InChI Key | SDSQWHUVRIBOQX-CIRFHOKZSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(C(O1)CC(=O)NCC2=CC=C(C=C2)OC)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353733 |