Systematic / IUPAC Name:
ID: Reference922
Other Names:
Formula: C22H20ClN3O4
Class: Counterfeit Drug (Therapeutic)
Tadalafil impurity D mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 76 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/31/2015 9:43:51 AM |
| InChI | InChI=1S/C22H20ClN3O4/c1-24-22(28)16-9-14-13-4-2-3-5-15(13)25-20(14)21(26(16)19(27)10-23)12-6-7-17-18(8-12)30-11-29-17/h2-8,16,21,25H,9-11H2,1H3,(H,24,28)/t16-,21+/m1/s1 |
| InChI Key | PCNIZAHOODODDG-IERDGZPVSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |