Systematic / IUPAC Name: 2-[(3R,4S)-3-[(5-Phenyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone
ID: Reference9232
Other Names:
Ethanone, 2-[(3R,4S)-3-[(5-phenyl-3-isoxazolyl)methyl]-4-piperidinyl]-1-[4-(2-pyridinyl)-1-piperazinyl]-;
NAT14-350143
Formula: C26H31N5O2
2-{(3R,4S)-3-[(5-Phenyl-1,2-oxazol-3-yl)methyl]-4-piperidinyl}-1-[4-(2-pyridinyl)-1-piperazinyl]ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1095 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/13/2019 10:12:01 AM |
| InChI | InChI=1S/C26H31N5O2/c32-26(31-14-12-30(13-15-31)25-8-4-5-10-28-25)17-21-9-11-27-19-22(21)16-23-18-24(33-29-23)20-6-2-1-3-7-20/h1-8,10,18,21-22,27H,9,11-17,19H2/t21-,22-/m0/s1 |
| InChI Key | KCCBDMQGZBDZMW-VXKWHMMOSA-N |
| Canonical SMILES | C1CNCC(C1CC(=O)N2CCN(CC2)C3=CC=CC=N3)CC4=NOC(=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 2-[(3R,4S)-3-[(5-phenyl-3-isoxazolyl)methyl]-4-piperidinyl]-1-[4-(2-pyridinyl)-1-piperazinyl]-; NAT14-350143 |