Systematic / IUPAC Name: 5-{1-Hydroxy-2-[(2-methyl-2-propanyl)amino]ethyl}-1,3-benzenediol
ID: Reference924
Other Names:
5-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,3-diol;
Benzyl alcohol, α-((tert-butylamino)methyl)-3,5-dihydroxy-;
5-{2-[(1,1-Dimethylethyl)amino]-1-hydroxyethyl}benzene-1,3-diol;
1,3-Benzenediol, 5-[2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-;
Brethaire
; more
Formula: C12H19NO3
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Terbutaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 107 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/31/2015 10:20:08 AM |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 |
| InChI Key | XWTYSIMOBUGWOL-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)O)O)O |
| CAS | 46719293 |
| Splash | |
| Other Names |
5-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,3-diol; Benzyl alcohol, α-((tert-butylamino)methyl)-3,5-dihydroxy-; 5-{2-[(1,1-Dimethylethyl)amino]-1-hydroxyethyl}benzene-1,3-diol; 1,3-Benzenediol, 5-[2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-; Brethaire; Brethine; Bricanyl; Terbutalin; Brican; Bricaril; Bricar; Bricyn |
| DrugBank | APRD00589 |
| ChemSpider | 5210 |
| PubChem | 5403 |
| ChEBI | CHEBI:9449 |
| ChemIDPlus | 023031256; 046719293 |
| KEGG | C07129; D08570 |
| ChEMBL | CHEMBL1760 |
| Wikipedia | Terbutaline |