Systematic / IUPAC Name:
ID: Reference9267
Other Names:
Formula: C16H11N3O
3-(2-(Phenylamino)oxazol-5-yl)benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1190 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/10/2020 9:39:26 AM |
| InChI | InChI=1S/C16H11N3O/c17-10-12-5-4-6-13(9-12)15-11-18-16(20-15)19-14-7-2-1-3-8-14/h1-9,11H,(H,18,19) |
| InChI Key | XGZWIADFZMBODB-UHFFFAOYSA-N |
| Canonical SMILES | c1c(cccc1)Nc1oc(cn1)c1cccc(c1)C#N |
| CAS | |
| Splash | |
| Other Names |