Systematic / IUPAC Name:
ID: Reference9291
Other Names:
Formula: C16H10N4O3
4-((5-(4-Nitrophenyl)oxazol-2-yl)amino)benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2105 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2020 9:19:33 AM |
| InChI | InChI=1S/C16H10N4O3/c17-9-11-1-5-13(6-2-11)19-16-18-10-15(23-16)12-3-7-14(8-4-12)20(21)22/h1-8,10H,(H,18,19) |
| InChI Key | GMLOBUXFXCTUTK-UHFFFAOYSA-N |
| Canonical SMILES | c1c(ccc(c1)C#N)Nc1oc(cn1)c1ccc(cc1)N(=O)=O |
| CAS | |
| Splash | |
| Other Names |