Systematic / IUPAC Name:
ID: Reference9294
Other Names:
Formula: C17H10N4O
4-(2-((4-Cyanophenyl)amino)oxazol-5-yl)benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 389 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2020 9:39:01 AM |
| InChI | InChI=1S/C17H10N4O/c18-9-12-1-5-14(6-2-12)16-11-20-17(22-16)21-15-7-3-13(10-19)4-8-15/h1-8,11H,(H,20,21) |
| InChI Key | SZULQUOUQZELAW-UHFFFAOYSA-N |
| Canonical SMILES | c1c(ccc(c1)C#N)Nc1oc(cn1)c1ccc(cc1)C#N |
| CAS | |
| Splash | |
| Other Names |