Systematic / IUPAC Name: [(2R,4S,5R)-5-[6-(4-Fluorophenyl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-cyclohexylcarbamate
ID: Reference9303
Other Names:
Carbamic acid, N-cyclohexyl-, [(2R,4S,5R)-5-[6-(4-fluorophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-340154
Formula: C26H33FN4O2
{(2R,4S,5R)-5-[6-(4-Fluorophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl cyclohexylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 225 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2020 9:52:15 AM |
| InChI | InChI=1S/C26H33FN4O2/c1-17-28-24(18-7-9-20(27)10-8-18)14-25(29-17)23-15-31-12-11-19(23)13-22(31)16-33-26(32)30-21-5-3-2-4-6-21/h7-10,14,19,21-23H,2-6,11-13,15-16H2,1H3,(H,30,32)/t19-,22+,23-/m0/s1 |
| InChI Key | PQMVEYBRJZQPHF-PMOQBDJRSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3COC(=O)NC4CCCCC4)C5=CC=C(C=C5)F |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-cyclohexyl-, [(2R,4S,5R)-5-[6-(4-fluorophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-340154 |