Systematic / IUPAC Name: Triphenylphosphine oxide
ID: Reference932
Other Names:
Phosphine oxide, triphenyl-;
Triphenylphosphane oxide;
Triphenylphosphanoxide;
Triphenylphosphino-1-one;
Phosphorane, triphenyl-, oxide
Formula: C18H15OP
Triphenylphosphine oxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/1/2015 7:54:25 AM |
| InChI | InChI=1S/C18H15OP/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChI Key | FIQMHBFVRAXMOP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | 791286 |
| Splash | |
| Other Names |
Phosphine oxide, triphenyl-; Triphenylphosphane oxide; Triphenylphosphanoxide; Triphenylphosphino-1-one; Phosphorane, triphenyl-, oxide |
| ChEBI | CHEBI:36601 |
| Wikipedia | Triphenylphosphine oxide |
| ChemSpider | 12549 |
| PubChem | 13097 |
| ChEMBL | CHEMBL482091 |
| ChemIDPlus | 000791286 |