Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-yl]methyl]-4-methoxybenzamide
ID: Reference9343
Other Names: NAT19-353943
Formula: C24H30N4O6
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl}tetrahydro-2-furanyl]methyl}-4-methoxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2620 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/30/2020 1:13:16 PM |
| InChI | InChI=1S/C24H30N4O6/c1-33-17-7-5-16(6-8-17)24(32)26-15-19-23(31)22(30)18(34-19)14-21(29)28-12-10-27(11-13-28)20-4-2-3-9-25-20/h2-9,18-19,22-23,30-31H,10-15H2,1H3,(H,26,32)/t18-,19+,22-,23+/m0/s1 |
| InChI Key | PSSASBMZLDDJEZ-JFSTXAPLSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)NCC2C(C(C(O2)CC(=O)N3CCN(CC3)C4=CC=CC=N4)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353943 |