Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-yl]methyl]-3-fluorobenzamide
ID: Reference9365
Other Names: NAT19-353942
Formula: C23H27FN4O5
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-oxo-2-[4-(2-pyridinyl)-1-piperazinyl]ethyl}tetrahydro-2-furanyl]methyl}-3-fluorobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3839 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/6/2020 7:58:08 AM |
| InChI | InChI=1S/C23H27FN4O5/c24-16-5-3-4-15(12-16)23(32)26-14-18-22(31)21(30)17(33-18)13-20(29)28-10-8-27(9-11-28)19-6-1-2-7-25-19/h1-7,12,17-18,21-22,30-31H,8-11,13-14H2,(H,26,32)/t17-,18+,21-,22+/m0/s1 |
| InChI Key | JOIBLCXEZPUALU-GKJHBJHPSA-N |
| Canonical SMILES | C1CN(CCN1C2=CC=CC=N2)C(=O)CC3C(C(C(O3)CNC(=O)C4=CC(=CC=C4)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353942 |