Systematic / IUPAC Name: 5-[3-[(2-Chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol
ID: Reference9381
Other Names:
3-Pyrrolidinol, 5-[3-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-;
NAT18-382949
Formula: C13H13ClFN3O2
5-[3-(2-Chloro-4-fluorobenzyl)-1,2,4-oxadiazol-5-yl]-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 165 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/17/2020 8:27:49 AM |
| InChI | InChI=1S/C13H13ClFN3O2/c14-10-4-8(15)2-1-7(10)3-12-17-13(20-18-12)11-5-9(19)6-16-11/h1-2,4,9,11,16,19H,3,5-6H2 |
| InChI Key | WBGOUPRWTBTSAH-UHFFFAOYSA-N |
| Canonical SMILES | C1C(CNC1C2=NC(=NO2)CC3=C(C=C(C=C3)F)Cl)O |
| CAS | |
| Splash | |
| Other Names |
3-Pyrrolidinol, 5-[3-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-; NAT18-382949 |