Systematic / IUPAC Name: 2,3-Dihydroxypropyl stearate
ID: Reference939
Other Names:
Octadecanoic acid, 2,3-dihydroxypropyl ester;
Stearic acid 1-monoglyceride;
3-Stearoyloxy-1,2-propanediol;
2,3-Dihydroxypropyl octadecanoate;
Rac-2,3-dihydroxypropyl octadecanoate
; more
Formula: C21H42O4
Class: Endogenous Metabolites Excipients/Additives/Colorants
1-Stearoylglycerol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/2/2015 10:34:38 AM |
| InChI | InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChI Key | VBICKXHEKHSIBG-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(CO)O |
| CAS | 123944 |
| Splash | |
| Other Names |
Octadecanoic acid, 2,3-dihydroxypropyl ester; Stearic acid 1-monoglyceride; 3-Stearoyloxy-1,2-propanediol; 2,3-Dihydroxypropyl octadecanoate; Rac-2,3-dihydroxypropyl octadecanoate; Tegin; Stearin, 1-mono-; 1-Monostearin; α-Monostearin; Glycerin 1-monostearate; 1-Glyceryl stearate; Glycerin 1-stearate; 1-Monostearoylglycerol; Emerest ; Glycerol 1-monostearate; Glycerol α-monostearate; Rac-glycerol 1-stearate; DL-α-Stearin; Glyceryl-1-monostearate; Rac-glyceryl monostearate |
| PubChem | 24699 |
| LipidsMAPs | LMGL01010003 |
| Wikipedia | Glycerol monostearate |
| KEGG | D01947 |
| ChEBI | CHEBI:75555; CHEBI:75557 |
| ChemIDPlus | 000123944; 031566311; 014811928; 083138629 |
| ChemSpider | 23095 |
| ChEMBL | CHEMBL255696 |