Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]oxolan-2-yl]methyl]-3-fluorobenzamide
ID: Reference9400
Other Names: NAT19-353726
Formula: C22H25FN2O6
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[(4-methoxybenzyl)amino]-2-oxoethyl}tetrahydro-2-furanyl]methyl}-3-fluorobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3440 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/20/2020 1:21:06 PM |
| InChI | InChI=1S/C22H25FN2O6/c1-30-16-7-5-13(6-8-16)11-24-19(26)10-17-20(27)21(28)18(31-17)12-25-22(29)14-3-2-4-15(23)9-14/h2-9,17-18,20-21,27-28H,10-12H2,1H3,(H,24,26)(H,25,29)/t17-,18+,20-,21+/m0/s1 |
| InChI Key | KVAYYRJICKWTFQ-IZZBFERCSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNC(=O)CC2C(C(C(O2)CNC(=O)C3=CC(=CC=C3)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353726 |