Systematic / IUPAC Name: N-[[(2R,3S,4R,5S)-3,4-Dihydroxy-5-[2-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]oxolan-2-yl]methyl]-3-fluorobenzamide
ID: Reference9419
Other Names: NAT19-353861
Formula: C20H27FN2O6
N-{[(2R,3S,4R,5S)-3,4-Dihydroxy-5-{2-[(2R)-2-(methoxymethyl)-1-pyrrolidinyl]-2-oxoethyl}tetrahydro-2-furanyl]methyl}-3-fluorobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4174 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/28/2020 11:39:50 AM |
| InChI | InChI=1S/C20H27FN2O6/c1-28-11-14-6-3-7-23(14)17(24)9-15-18(25)19(26)16(29-15)10-22-20(27)12-4-2-5-13(21)8-12/h2,4-5,8,14-16,18-19,25-26H,3,6-7,9-11H2,1H3,(H,22,27)/t14-,15+,16-,18+,19-/m1/s1 |
| InChI Key | AQNZAIDALQZJNI-NZKYLMMGSA-N |
| Canonical SMILES | COCC1CCCN1C(=O)CC2C(C(C(O2)CNC(=O)C3=CC(=CC=C3)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353861 |