Systematic / IUPAC Name: 4-Fluoro-N-[[(1S,4S,6S)-3-methyl-4-[2-oxo-2-(pyridin-2-ylamino)ethyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide
ID: Reference9507
Other Names: NAT28-408804
Formula: C25H30FN3O2
4-Fluoro-N-[[(1S,4S,6S)-6-isopropyl-3-methyl-4-[2-oxo-2-(2-pyridylamino)ethyl]cyclohex-2-en-1-yl]methyl]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3575 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/19/2020 6:36:01 AM |
| InChI | InChI=1S/C25H30FN3O2/c1-16(2)22-13-19(14-24(30)29-23-6-4-5-11-27-23)17(3)12-20(22)15-28-25(31)18-7-9-21(26)10-8-18/h4-12,16,19-20,22H,13-15H2,1-3H3,(H,28,31)(H,27,29,30)/t19-,20-,22-/m0/s1 |
| InChI Key | OIVAJJZZAYFRRZ-ONTIZHBOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2=CC=CC=N2)C(C)C)CNC(=O)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | NAT28-408804 |