Systematic / IUPAC Name: 2-[(1S,4S,5S)-2-Methyl-5-propan-2-yl-4-[(propan-2-ylcarbamoylamino)methyl]cyclohex-2-en-1-yl]-N-pyridin-2-ylacetamide
ID: Reference9526
Other Names: NAT28-408767
Formula: C22H34N4O2
2-[(1S,4S,5S)-5-Isopropyl-4-[(isopropylcarbamoylamino)methyl]-2-methyl-cyclohex-2-en-1-yl]-N-(2-pyridyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2590 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/26/2020 4:53:02 PM |
| InChI | InChI=1S/C22H34N4O2/c1-14(2)19-11-17(12-21(27)26-20-8-6-7-9-23-20)16(5)10-18(19)13-24-22(28)25-15(3)4/h6-10,14-15,17-19H,11-13H2,1-5H3,(H,23,26,27)(H2,24,25,28)/t17-,18-,19-/m0/s1 |
| InChI Key | YNFKPRKGBZOYSQ-FHWLQOOXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2=CC=CC=N2)C(C)C)CNC(=O)NC(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-408767 |