Systematic / IUPAC Name: (1R,3R)-1-(1,3-Benzodioxol-5-yl)-N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide
ID: Reference954
Other Names:
Formula: C20H19N3O3
Class: Counterfeit Drug (Therapeutic) Illegal Additives
Tadalafil impurity A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 75 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/30/2014 3:27:24 PM |
| InChI | InChI=1S/C20H19N3O3/c1-21-20(24)15-9-13-12-4-2-3-5-14(12)22-19(13)18(23-15)11-6-7-16-17(8-11)26-10-25-16/h2-8,15,18,22-23H,9-10H2,1H3,(H,21,24)/t15-,18-/m1/s1 |
| InChI Key | QWRJNDUNSMFZTP-CRAIPNDOSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |