Systematic / IUPAC Name: 2-Benzyl-5-[(3S)-1-cyclohexylpyrrolidin-3-yl]-1,3,4-oxadiazole
ID: Reference9565
Other Names:
1,3,4-Oxadiazole, 2-[(3S)-1-cyclohexyl-3-pyrrolidinyl]-5-(phenylmethyl)-;
NAT31-459400
Formula: C19H25N3O
2-Benzyl-5-[(3S)-1-cyclohexyl-3-pyrrolidinyl]-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1208 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2020 12:18:35 PM |
| InChI | InChI=1S/C19H25N3O/c1-3-7-15(8-4-1)13-18-20-21-19(23-18)16-11-12-22(14-16)17-9-5-2-6-10-17/h1,3-4,7-8,16-17H,2,5-6,9-14H2/t16-/m0/s1 |
| InChI Key | BHUJNVNGMNCNMN-INIZCTEOSA-N |
| Canonical SMILES | C1CCC(CC1)N2CCC(C2)C3=NN=C(O3)CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
1,3,4-Oxadiazole, 2-[(3S)-1-cyclohexyl-3-pyrrolidinyl]-5-(phenylmethyl)-; NAT31-459400 |
| PubChem | 51137387 |
| ChEMBL | CHEMBL3437248 |
| ChemSpider | 29850391 |