Systematic / IUPAC Name: 2-[(3S)-1-[(2-Chlorophenyl)methyl]pyrrolidin-3-yl]-5-methyl-1,3,4-oxadiazole
ID: Reference9567
Other Names:
1,3,4-Oxadiazole, 2-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]-5-methyl-;
NAT31-458449
Formula: C14H16ClN3O
2-[(3S)-1-(2-Chlorobenzyl)-3-pyrrolidinyl]-5-methyl-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 300 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2020 12:43:29 PM |
| InChI | InChI=1S/C14H16ClN3O/c1-10-16-17-14(19-10)12-6-7-18(9-12)8-11-4-2-3-5-13(11)15/h2-5,12H,6-9H2,1H3/t12-/m0/s1 |
| InChI Key | BHMRXFAEWZSYRV-LBPRGKRZSA-N |
| Canonical SMILES | CC1=NN=C(O1)C2CCN(C2)CC3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names |
1,3,4-Oxadiazole, 2-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]-5-methyl-; NAT31-458449 |