Systematic / IUPAC Name: N-(2-Amino-2-oxoethyl)-4-(cyclohexylcarbamoylamino)-N-methyl-1-(2-methylsulfanylacetyl)pyrrolidine-2-carboxamide
ID: Reference9571
Other Names:
Glycinamide, 4-[[(cyclohexylamino)carbonyl]amino]-1-[2-(methylthio)acetyl]prolyl-N2-methyl-;
NAT3-155249
Formula: C18H31N5O4S
4-[(Cyclohexylcarbamoyl)amino]-1-[(methylsulfanyl)acetyl]prolyl-N2-methylglycinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3430 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2020 2:52:16 PM |
| InChI | InChI=1S/C18H31N5O4S/c1-22(10-15(19)24)17(26)14-8-13(9-23(14)16(25)11-28-2)21-18(27)20-12-6-4-3-5-7-12/h12-14H,3-11H2,1-2H3,(H2,19,24)(H2,20,21,27) |
| InChI Key | HLPAGWPESWGRCB-UHFFFAOYSA-N |
| Canonical SMILES | CN(CC(=O)N)C(=O)C1CC(CN1C(=O)CSC)NC(=O)NC2CCCCC2 |
| CAS | |
| Splash | |
| Other Names |
Glycinamide, 4-[[(cyclohexylamino)carbonyl]amino]-1-[2-(methylthio)acetyl]prolyl-N2-methyl-; NAT3-155249 |