Systematic / IUPAC Name: 5-Methoxy-2-[[(2S)-2-[3-[2-(2-methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]phenol
ID: Reference9647
Other Names:
Phenol, 5-methoxy-2-[[(2S)-2-[3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-1-pyrrolidinyl]methyl]-;
NAT18-430279
Formula: C22H26N4O5
5-Methoxy-2-{[(2S)-2-{3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3158 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2020 7:18:41 AM |
| InChI | InChI=1S/C22H26N4O5/c1-28-11-12-30-21-17(5-3-9-23-21)20-24-22(31-25-20)18-6-4-10-26(18)14-15-7-8-16(29-2)13-19(15)27/h3,5,7-9,13,18,27H,4,6,10-12,14H2,1-2H3/t18-/m0/s1 |
| InChI Key | HUKYGJOQZDRYLI-SFHVURJKSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=C(C=C(C=C4)OC)O |
| CAS | |
| Splash | |
| Other Names |
Phenol, 5-methoxy-2-[[(2S)-2-[3-[2-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-1-pyrrolidinyl]methyl]-; NAT18-430279 |