Systematic / IUPAC Name: 4-[[(2S)-2-[3-[6-(2-Methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]-N,N-dimethylaniline
ID: Reference9648
Other Names:
Benzenamine, 4-[[(2S)-2-[3-[6-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-1-pyrrolidinyl]methyl]-N,N-dimethyl-;
NAT18-432637
Formula: C23H29N5O3
4-{[(2S)-2-{3-[6-(2-Methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-N,N-dimethylaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 430 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2020 7:19:15 AM |
| InChI | InChI=1S/C23H29N5O3/c1-27(2)19-9-6-17(7-10-19)16-28-12-4-5-20(28)23-25-22(26-31-23)18-8-11-21(24-15-18)30-14-13-29-3/h6-11,15,20H,4-5,12-14,16H2,1-3H3/t20-/m0/s1 |
| InChI Key | PJKZLYRMEUKVLM-FQEVSTJZSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)CN2CCCC2C3=NC(=NO3)C4=CN=C(C=C4)OCCOC |
| CAS | |
| Splash | |
| Other Names |
Benzenamine, 4-[[(2S)-2-[3-[6-(2-methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl]-1-pyrrolidinyl]methyl]-N,N-dimethyl-; NAT18-432637 |