Systematic / IUPAC Name: 2-[(3S)-1-(1,3-Benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-5-methyl-1,3-benzoxazole
ID: Reference9662
Other Names:
Benzoxazole, 2-[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pyrrolidinyl]-5-methyl-;
NAT31-456749
Formula: C20H20N2O3
2-[(3S)-1-(1,3-Benzodioxol-5-ylmethyl)-3-pyrrolidinyl]-5-methyl-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 305 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/4/2020 11:07:48 AM |
| InChI | InChI=1S/C20H20N2O3/c1-13-2-4-17-16(8-13)21-20(25-17)15-6-7-22(11-15)10-14-3-5-18-19(9-14)24-12-23-18/h2-5,8-9,15H,6-7,10-12H2,1H3/t15-/m0/s1 |
| InChI Key | JTKBQYJHIPZJQZ-HNNXBMFYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)OC(=N2)C3CCN(C3)CC4=CC5=C(C=C4)OCO5 |
| CAS | |
| Splash | |
| Other Names |
Benzoxazole, 2-[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pyrrolidinyl]-5-methyl-; NAT31-456749 |