Systematic / IUPAC Name: 5-[(2S)-1-[(2-Methoxyphenyl)methyl]pyrrolidin-2-yl]-3-(6-methoxypyridin-3-yl)-1,2,4-oxadiazole
ID: Reference9682
Other Names:
Pyridine, 2-methoxy-5-[5-[(2S)-1-[(2-methoxyphenyl)methyl]-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-;
NAT18-443192
Formula: C20H22N4O3
2-Methoxy-5-{5-[(2S)-1-(2-methoxybenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 809 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/15/2020 12:21:56 PM |
| InChI | InChI=1S/C20H22N4O3/c1-25-17-8-4-3-6-15(17)13-24-11-5-7-16(24)20-22-19(23-27-20)14-9-10-18(26-2)21-12-14/h3-4,6,8-10,12,16H,5,7,11,13H2,1-2H3/t16-/m0/s1 |
| InChI Key | GHMCAGVBVGPVIK-INIZCTEOSA-N |
| Canonical SMILES | COC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4OC |
| CAS | |
| Splash | |
| Other Names |
Pyridine, 2-methoxy-5-[5-[(2S)-1-[(2-methoxyphenyl)methyl]-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-; NAT18-443192 |