Systematic / IUPAC Name: 2-[(3S)-1-[(3,4-Difluorophenyl)methyl]pyrrolidin-3-yl]-5-methyl-1,3-benzoxazole
ID: Reference9692
Other Names:
Benzoxazole, 2-[(3S)-1-[(3,4-difluorophenyl)methyl]-3-pyrrolidinyl]-5-methyl-;
NAT31-456732
Formula: C19H18F2N2O
2-[(3S)-1-(3,4-Difluorobenzyl)-3-pyrrolidinyl]-5-methyl-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 861 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/15/2020 10:08:11 AM |
| InChI | InChI=1S/C19H18F2N2O/c1-12-2-5-18-17(8-12)22-19(24-18)14-6-7-23(11-14)10-13-3-4-15(20)16(21)9-13/h2-5,8-9,14H,6-7,10-11H2,1H3/t14-/m0/s1 |
| InChI Key | BVOGJBZCBNCGFE-AWEZNQCLSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)OC(=N2)C3CCN(C3)CC4=CC(=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names |
Benzoxazole, 2-[(3S)-1-[(3,4-difluorophenyl)methyl]-3-pyrrolidinyl]-5-methyl-; NAT31-456732 |