Systematic / IUPAC Name: 2-Ethyl-N-[[(2R,4S,5R)-5-[6-(furan-2-yl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]butanamide
ID: Reference9721
Other Names:
Butanamide, 2-ethyl-N-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342932
Formula: C23H32N4O2
2-Ethyl-N-({(2R,4S,5R)-5-[6-(2-furyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)butanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2116 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2020 7:13:06 AM |
| InChI | InChI=1S/C23H32N4O2/c1-4-16(5-2)23(28)24-13-18-11-17-8-9-27(18)14-19(17)20-12-21(26-15(3)25-20)22-7-6-10-29-22/h6-7,10,12,16-19H,4-5,8-9,11,13-14H2,1-3H3,(H,24,28)/t17-,18+,19-/m0/s1 |
| InChI Key | GXTOHSQVMJIERT-OTWHNJEPSA-N |
| Canonical SMILES | CCC(CC)C(=O)NCC1CC2CCN1CC2C3=NC(=NC(=C3)C4=CC=CO4)C |
| CAS | |
| Splash | |
| Other Names |
Butanamide, 2-ethyl-N-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342932 |