Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[6-(Furan-2-yl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-carboxamide
ID: Reference9722
Other Names:
2-Thiophenecarboxamide, N-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342928
Formula: C22H24N4O2S
N-({(2R,4S,5R)-5-[6-(2-Furyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-2-thiophenecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1142 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2020 7:14:08 AM |
| InChI | InChI=1S/C22H24N4O2S/c1-14-24-18(11-19(25-14)20-4-2-8-28-20)17-13-26-7-6-15(17)10-16(26)12-23-22(27)21-5-3-9-29-21/h2-5,8-9,11,15-17H,6-7,10,12-13H2,1H3,(H,23,27)/t15-,16+,17-/m0/s1 |
| InChI Key | HENIKZZBCDTPKQ-BBWFWOEESA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)C4=CC=CS4)C5=CC=CO5 |
| CAS | |
| Splash | |
| Other Names |
2-Thiophenecarboxamide, N-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342928 |