Systematic / IUPAC Name: 1-Cyclohexyl-3-[[(2R,4S,5R)-5-[6-(furan-2-yl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9744
Other Names:
Urea, N-cyclohexyl-N'-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342985
Formula: C24H33N5O2
1-Cyclohexyl-3-({(2R,4S,5R)-5-[6-(2-furyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1020 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/5/2020 8:16:21 AM |
| InChI | InChI=1S/C24H33N5O2/c1-16-26-21(13-22(27-16)23-8-5-11-31-23)20-15-29-10-9-17(20)12-19(29)14-25-24(30)28-18-6-3-2-4-7-18/h5,8,11,13,17-20H,2-4,6-7,9-10,12,14-15H2,1H3,(H2,25,28,30)/t17-,19+,20-/m0/s1 |
| InChI Key | OZIYHSYPRLZCRL-SXLOBPIMSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)NC4CCCCC4)C5=CC=CO5 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-cyclohexyl-N'-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342985 |