Systematic / IUPAC Name: 2,6-Dichlorobenzamide
ID: Reference975
Other Names:
Benzamide, 2,6-dichloro-;
2,6-Bis(chloranyl)benzamide;
2,6-Dichlorobenzoic acid amide;
2,6-BAM
Formula: C7H5Cl2NO
Class: Pesticides/Herbicides
2,6-Dichlorobenzamide (BAM) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 495 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/1/2014 10:28:08 AM |
| InChI | InChI=1S/C7H5Cl2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChI Key | JHSPCUHPSIUQRB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)C(=O)N)Cl |
| CAS | 2008584 |
| Splash | |
| Other Names |
Benzamide, 2,6-dichloro-; 2,6-Bis(chloranyl)benzamide; 2,6-Dichlorobenzoic acid amide; 2,6-BAM |
| ChemSpider | 15359 |
| PubChem | 16183 |
| ChEBI | CHEBI:28435 |
| ChemIDPlus | 002008584 |
| KEGG | C10934 |