Systematic / IUPAC Name: 2-[[(4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,12-Dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid
ID: Reference9772
Other Names:
2-[[(3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl]amino]-ethanesulfonic acid;
Ethanesulfonic acid, 2-(((3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl)amino)-
Formula: C26H45NO6S
Class: Endogenous Metabolites
Taurodeoxycholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2517 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/27/2023 2:09:54 PM |
| InChI | InChI=1S/C26H45NO6S/c1-16(4-9-24(30)27-12-13-34(31,32)33)20-7-8-21-19-6-5-17-14-18(28)10-11-25(17,2)22(19)15-23(29)26(20,21)3/h16-23,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16?,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1 |
| InChI Key | AWDRATDZQPNJFN-DLYTVZRCSA-N |
| Canonical SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |
| CAS | |
| Splash | |
| Other Names |
2-[[(3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl]amino]-ethanesulfonic acid; Ethanesulfonic acid, 2-(((3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl)amino)- |
| PubChem | 10594 |
| ChemSpider | 10149 |
| ChemIDPlus | 000516507 |
| Wikipedia | Taurodeoxycholic acid |