Systematic / IUPAC Name: (5Z,9α,11α)-9,11-Dihydroxy-15-oxoprost-5-en-1-oic acid
ID: Reference9787
Other Names:
13,14-Dihydro-15-keto PGF2a;
13,14-Dihydro-15-keto-PGF2 α;
13,14-Dihydro-15-ketoprostaglandin F;
13,14-Dihydro-15-keto-prostaglandin F2a;
13,14-Dihydro-15-oxoprostaglandin F
; more
Formula: C20H34O5
Class: Endogenous Metabolites
13,14-Dihydro-15-keto prostaglandin F2α mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5060 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/22/2020 4:57:24 PM |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,16-19,22-23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t16-,17-,18+,19-/m1/s1 |
| InChI Key | VKTIONYPMSCHQI-XAGFEHLVSA-N |
| Canonical SMILES | CCCCCC(=O)CCC1C(CC(C1CC=CCCCC(=O)O)O)O |
| CAS | 27376767 |
| Splash | |
| Other Names |
13,14-Dihydro-15-keto PGF2a; 13,14-Dihydro-15-keto-PGF2 α; 13,14-Dihydro-15-ketoprostaglandin F; 13,14-Dihydro-15-keto-prostaglandin F2a; 13,14-Dihydro-15-oxoprostaglandin F; 15-Keto-13,14-dihydro-PGF2α; 15-Keto-13,14-dihydroprostaglandin F2-α; PGFM; (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-(3-oxooctyl)cyclopentyl]hept-5-enoic acid; 9S,11S-Dihydroxy-15-oxo-5Z-prostenoic acid; Prost-5-en-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,9α,11α)- |
| ChemIDPlus | 027376767 |
| ChEBI | CHEBI:63976 |
| HMDb | HMDB0004685 |
| ChemSpider | 4446166 |
| PubChem | 5283039 |