Systematic / IUPAC Name: 3-[(1R,2R,3R)-3-Hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]propanoic acid
ID: Reference9791
Other Names: 9,15-Dioxo-11α-hydroxy-2,3,4,5-tetranor-prostanoic acid
Formula: C16H26O5
Class: Endogenous Metabolites
3,14-dihydro-15-keto-tetranor Prostaglandin E2 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2729 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/25/2020 12:57:40 PM |
| InChI | InChI=1S/C16H26O5/c1-2-3-4-5-11(17)6-7-12-13(8-9-16(20)21)15(19)10-14(12)18/h12-14,18H,2-10H2,1H3,(H,20,21)/t12-,13-,14-/m1/s1 |
| InChI Key | FGACPXKRXBKDQL-MGPQQGTHSA-N |
| Canonical SMILES | CCCCCC(=O)CCC1C(CC(=O)C1CCC(=O)O)O |
| CAS | 20675858 |
| Splash | |
| Other Names | 9,15-Dioxo-11α-hydroxy-2,3,4,5-tetranor-prostanoic acid |