Systematic / IUPAC Name: Methyl (5Z,8Z,11Z,14Z)-16-(3-ethyl-2-oxiranyl)-5,8,11,14-hexadecatetraenoate
ID: Reference9792
Other Names:
(+/-)17,18-EEQ methyl ester;
(+/-)17,18-epoxy Eicosatetraenoic Acid methyl ester
Formula: C21H32O3
Class: Endogenous Metabolites
(+/-)17(18)-EpETE methyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 103 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/25/2020 12:59:54 PM |
| InChI | InChI=1S/C21H32O3/c1-3-19-20(24-19)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-21(22)23-2/h4,6-7,9-10,12-13,15,19-20H,3,5,8,11,14,16-18H2,1-2H3/b6-4-,9-7-,12-10-,15-13- |
| InChI Key | WXPZUUKQJWLIOW-GZDWWAIGSA-N |
| Canonical SMILES | CCC1C(O1)C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC |
| CAS | |
| Splash | |
| Other Names |
(+/-)17,18-EEQ methyl ester; (+/-)17,18-epoxy Eicosatetraenoic Acid methyl ester |
| ChemSpider | 71117145 |