Systematic / IUPAC Name: (3α,5β,6β,7β)-3,6,7-Trihydroxycholan-24-oic acid
ID: Reference9852
Other Names:
5b-Cholanic acid-3a,6b,7b-triol;
5β-Cholanic acid-3α,6β,7β-triol;
β-MCA;
b-Muricholic acid;
3,6,7-Trihydroxy-5β-cholan-24-oic acid
; more
Formula: C24H40O5
Class: Endogenous Metabolites
β-Muricholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 785 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/30/2020 7:22:50 AM |
| InChI | InChI=1S/C24H40O5/c1-13(4-7-19(26)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(25)12-18(24)21(28)22(20)29/h13-18,20-22,25,28-29H,4-12H2,1-3H3,(H,26,27)/t13-,14-,15-,16+,17+,18+,20+,21+,22-,23-,24-/m1/s1 |
| InChI Key | DKPMWHFRUGMUKF-CRKPLTDNSA-N |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2C(C(C4C3(CCC(C4)O)C)O)O)C |
| CAS | 239591 |
| Splash | |
| Other Names |
5b-Cholanic acid-3a,6b,7b-triol; 5β-Cholanic acid-3α,6β,7β-triol; β-MCA; b-Muricholic acid; 3,6,7-Trihydroxy-5β-cholan-24-oic acid; 3a,6b,7b-Trihydroxy-5b-cholan-24-oate; 3a,6b,7b-Trihydroxy-5b-cholan-24-oic acid; 3a,6b,7b-Trihydroxy-5b-cholanate; 3a,6b,7b-Trihydroxy-5b-cholanic acid; 3a,6b,7b-Trihydroxy-5b-cholanoate; 3a,6b,7b-Trihydroxy-5b-cholanoic acid; 3α,6β,7β-Trihydroxy-5β-cholan-24-oic acid; Cholan-24-oic acid, 3,6,7-trihydroxy-, (3a,5b,6b,7b)-; Cholan-24-oic acid, 3,6,7-trihydroxy-, (3α,5β,6β,7β)- |
| ChemSpider | 4446941 |
| PubChem | 5283853 |
| ChEBI | CHEBI:81298 |
| KEGG | C17726 |
| HMDb | HMDB0000415 |