Systematic / IUPAC Name: 1-(2,4-Difluorophenyl)-3-[(3S,5S)-1-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-yl]urea
ID: Reference9887
Other Names:
Urea, N-(2,4-difluorophenyl)-N'-[(3S,5S)-1-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinyl]-;
NAT18-383047
Formula: C20H19F2N5O2
1-(2,4-Difluorophenyl)-3-[(3S,5S)-1-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2038 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2020 6:30:27 AM |
| InChI | InChI=1S/C20H19F2N5O2/c1-27-11-14(23-20(28)24-16-8-7-13(21)9-15(16)22)10-17(27)19-25-18(26-29-19)12-5-3-2-4-6-12/h2-9,14,17H,10-11H2,1H3,(H2,23,24,28)/t14-,17-/m0/s1 |
| InChI Key | ALQIPBCOPJTNCA-YOEHRIQHSA-N |
| Canonical SMILES | CN1CC(CC1C2=NC(=NO2)C3=CC=CC=C3)NC(=O)NC4=C(C=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names |
Urea, N-(2,4-difluorophenyl)-N'-[(3S,5S)-1-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinyl]-; NAT18-383047 |