Systematic / IUPAC Name: (3S)-3-Amino-4-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino}-4-oxobutanoic acid
ID: Reference990
Other Names:
Aspartylphenylalanine methyl ester;
L-Aspartyl-L-phenylalanine methyl ester;
1-Methyl N-L-α-aspartyl-L-phenylalanate;
Methyl L-α-aspartyl-L-phenylalaninate;
3-Amino-N-(α-methoxycarbonylphenethyl) succinamic acid
; more
Formula: C14H18N2O5
Class: Excipients/Additives/Colorants
Aspartame mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 9:02:17 AM |
| InChI | InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 |
| InChI Key | IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| Canonical SMILES | COC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)O)N |
| CAS | 22839470 |
| Splash | |
| Other Names |
Aspartylphenylalanine methyl ester; L-Aspartyl-L-phenylalanine methyl ester; 1-Methyl N-L-α-aspartyl-L-phenylalanate; Methyl L-α-aspartyl-L-phenylalaninate; 3-Amino-N-(α-methoxycarbonylphenethyl) succinamic acid; 3-Amino-N-(α-carboxyphenethyl)succinamic acid N-methyl ester; Methyl aspartylphenylalanate; N-(L-α-Aspartyl)-L-phenylalanine methyl ester; Methyl N-L-α-aspartyl-L-phenylalaninate; L-Aspartyl-L-phenylalanyl methyl ester; L-Aspartyl-L-3-phenylalanine methyl ester; N-L-α-Aspartyl L-phenylalanine 1-methyl ester; Nutrasweet; Canderel; Equal |
| Wikipedia | Aspartame |
| ChEBI | CHEBI:2877 |
| PubChem | 134601 |
| KEGG | D02381; C11045 |
| HMDb | HMDB01894 |
| ChEMBL | CHEMBL171679 |
| ChemSpider | 118630 |