Systematic / IUPAC Name: 4,4'-Carbonimidoylbis(N,N-dimethylaniline)
ID: Reference9906
Other Names:
Auramine base;
Auramine manufacture;
Auramine N base;
Auramine O base;
Auramine O free base
; more
Formula: C17H21N3
Class: Extractables/Leachables Excipients/Additives/Colorants Textile Chemicals/Auxiliary/Dyes
Auramine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 480 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2020 7:03:25 AM |
| InChI | InChI=1S/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 |
| InChI Key | JPIYZTWMUGTEHX-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C |
| CAS | |
| Splash | |
| Other Names |
Auramine base; Auramine manufacture; Auramine N base; Auramine O base; Auramine O free base; Auramine oaf; Auramine OO; Auramine SS; Auremine; Blauramine; CI Basic yellow 2, free base; CI Solvent yellow 34; Glauramine; Orient oil yellow 101; Solvent yellow 34; Waxoline yellow D; Waxoline yellow O; Yellow pyoctanine; (4-{[4-(Dimethylamino)phenyl]iminomethyl}phenyl)dimethylamine; 4,4'-(Imidocarbonyl)bis(N,N-dimethylaniline); 4,4'-Carbonimidoylbis(N,N-dimethylbenzenamine); 4,4'-Dimethylaminobenzophenonimide; Aniline, 4,4'-imidocarbonylbis(N,N-dimethyl-; Benzenamine, 4,4'-carbonimidoylbis[N,N-dimethyl-; Bis(p-dimethylaminophenyl)methyleneimine; Carbonoimidoylbis(N,N-dimethylbenzenamine); Tetramethyldiaminodiphenylacetimine; Tetramethyl-p-diamino-imido-benzophenone |
| ChemIDPlus | 000492808 |
| ChEMBL | CHEMBL1626329 |
| Wikipedia | Auramine O |
| ChEBI | CHEBI:51874 |
| KEGG | C19193 |
| WebBook | 3865373923 |
| ChemSpider | 9876 |
| PubChem | 10298 |